C22H31FN4O3 — CID 111681890
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111681890) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111681890 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | C/N=C(/NCC(C)Oc1cccc(F)c1)NCC(c1ccc(C)o1)N1CCOCC1 |
| InChI | InChI=1S/C22H31FN4O3/c1-16-7-8-21(30-16)20(27-9-11-28-12-10-27)15-26-22(24-3)25-14-17(2)29-19-6-4-5-18(23)13-19/h4-8,13,17,20H,9-12,14-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | PITGRESEJNBYAD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|