C22H30FN5O2 — CID 111681946
1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111681946) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111681946 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCOC(C)C2)nc1)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C22H30FN5O2/c1-16(30-20-6-4-5-19(23)11-20)12-26-22(24-3)27-14-18-7-8-21(25-13-18)28-9-10-29-17(2)15-28/h4-8,11,13,16-17H,9-10,12,14-15H2,1-3H3,(H2,24,26,27) |
| InChIKey | DEWUKRYZHQCZJN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|