C18H25FN4OS — CID 111681964
1-ethyl-2-[2-(3-fluorophenoxy)propyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111681964) has the molecular formula C18H25FN4OS and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenoxy)propyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenoxy)propyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111681964 |
| Molecular Formula | C18H25FN4OS |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenoxy)propyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1cccc(F)c1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C18H25FN4OS/c1-4-20-18(21-9-8-16-12-25-14(3)23-16)22-11-13(2)24-17-7-5-6-15(19)10-17/h5-7,10,12-13H,4,8-9,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | NUBUZZJHQDLIIZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|