C24H25ClN4O6S — CID 11168580
2-chloro-1-(2-methoxyquinolin-3-yl)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethanone (PubChem CID 11168580) has the molecular formula C24H25ClN4O6S and a molecular weight of 533.01 g/mol. Its IUPAC name is 2-chloro-1-(2-methoxyquinolin-3-yl)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethanone.
| Compound Name | 2-chloro-1-(2-methoxyquinolin-3-yl)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 11168580 |
| Molecular Formula | C24H25ClN4O6S |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-chloro-1-(2-methoxyquinolin-3-yl)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethanone |
| SMILES | COc1nc2ccccc2cc1C(=O)C(Cl)c1cc(CN2CCN(S(C)(=O)=O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25ClN4O6S/c1-35-24-19(14-17-5-3-4-6-20(17)26-24)23(30)22(25)18-13-16(7-8-21(18)29(31)32)15-27-9-11-28(12-10-27)36(2,33)34/h3-8,13-14,22H,9-12,15H2,1-2H3 |
| InChIKey | OPLHHZVUEHCRCC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|