C24H26N4O5S — CID 11271626
2-methoxy-3-[(E)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethenyl]quinoline (PubChem CID 11271626) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-methoxy-3-[(E)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethenyl]quinoline.
| Compound Name | 2-methoxy-3-[(E)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethenyl]quinoline |
|---|---|
| PubChem CID | 11271626 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-methoxy-3-[(E)-2-[5-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-nitrophenyl]ethenyl]quinoline |
| SMILES | COc1nc2ccccc2cc1/C=C/c1cc(CN2CCN(S(C)(=O)=O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H26N4O5S/c1-33-24-21(16-19-5-3-4-6-22(19)25-24)9-8-20-15-18(7-10-23(20)28(29)30)17-26-11-13-27(14-12-26)34(2,31)32/h3-10,15-16H,11-14,17H2,1-2H3/b9-8+ |
| InChIKey | SRIKMCNGADKCNA-CMDGGOBGSA-N |
| XLogP | 3.40 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|