C25H27N3O4 — CID 11189704
2-methoxy-3-[(E)-2-[2-nitro-5-(2-piperidin-1-ylethoxy)phenyl]ethenyl]quinoline (PubChem CID 11189704) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-methoxy-3-[(E)-2-[2-nitro-5-(2-piperidin-1-ylethoxy)phenyl]ethenyl]quinoline.
| Compound Name | 2-methoxy-3-[(E)-2-[2-nitro-5-(2-piperidin-1-ylethoxy)phenyl]ethenyl]quinoline |
|---|---|
| PubChem CID | 11189704 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-methoxy-3-[(E)-2-[2-nitro-5-(2-piperidin-1-ylethoxy)phenyl]ethenyl]quinoline |
| SMILES | COc1nc2ccccc2cc1/C=C/c1cc(OCCN2CCCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27N3O4/c1-31-25-21(17-19-7-3-4-8-23(19)26-25)10-9-20-18-22(11-12-24(20)28(29)30)32-16-15-27-13-5-2-6-14-27/h3-4,7-12,17-18H,2,5-6,13-16H2,1H3/b10-9+ |
| InChIKey | PTKNPMOWQXRBAQ-MDZDMXLPSA-N |
| XLogP | 5.19 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|