C21H26N2O4 — CID 174719912
1-[3-(2-nitro-5-phenylmethoxyphenoxy)propyl]piperidine (PubChem CID 174719912) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[3-(2-nitro-5-phenylmethoxyphenoxy)propyl]piperidine.
| Compound Name | 1-[3-(2-nitro-5-phenylmethoxyphenoxy)propyl]piperidine |
|---|---|
| PubChem CID | 174719912 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[3-(2-nitro-5-phenylmethoxyphenoxy)propyl]piperidine |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccccc2)cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C21H26N2O4/c24-23(25)20-11-10-19(27-17-18-8-3-1-4-9-18)16-21(20)26-15-7-14-22-12-5-2-6-13-22/h1,3-4,8-11,16H,2,5-7,12-15,17H2 |
| InChIKey | OTVYZVJZXGVCBF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|