About CID 68839040
CID 68839040 (PubChem CID 68839040) has the molecular formula C19H24NO4Si
and a molecular weight of 358.49 g/mol.
Molecular Properties
| Compound Name | CID 68839040 |
| PubChem CID | 68839040 |
| Molecular Formula | C19H24NO4Si |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)C(C)(C)COc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H24NO4Si/c1-19(2,25(3)4)14-24-16-10-11-17(20(21)22)18(12-16)23-13-15-8-6-5-7-9-15/h5-12H,13-14H2,1-4H3 |
| InChIKey | FDZJCBAVOKAYAA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 68839040 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68839040?
The IUPAC name of CID 68839040 (CID 68839040) is not available.
What is the SMILES notation for CID 68839040?
The canonical SMILES for CID 68839040 is C[Si](C)C(C)(C)COc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1.
What is the InChIKey of CID 68839040?
The InChIKey is FDZJCBAVOKAYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24NO4Si/c1-19(2,25(3)4)14-24-16-10-11-17(20(21)22)18(12-16)23-13-15-8-6-5-7-9-15/h5-12H,13-14H2,1-4H3.
What are the key properties of CID 68839040?
CID 68839040 has a molecular weight of 358.49 g/mol, XLogP of 5.09, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68839040 is sourced from PubChem (CID 68839040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).