C14H19N3O2 — CID 163772976
1-[(3-ethenyl-4-nitrophenyl)methyl]-4-methylpiperazine (PubChem CID 163772976) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-[(3-ethenyl-4-nitrophenyl)methyl]-4-methylpiperazine.
| Compound Name | 1-[(3-ethenyl-4-nitrophenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 163772976 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[(3-ethenyl-4-nitrophenyl)methyl]-4-methylpiperazine |
| SMILES | C=Cc1cc(CN2CCN(C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O2/c1-3-13-10-12(4-5-14(13)17(18)19)11-16-8-6-15(2)7-9-16/h3-5,10H,1,6-9,11H2,2H3 |
| InChIKey | MIAAPJHTMRJRMO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|