C19H26F3IN6OS — CID 111689657
2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689657) has the molecular formula C19H26F3IN6OS and a molecular weight of 570.42 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689657 |
| Molecular Formula | C19H26F3IN6OS |
| Molecular Weight | 570.42 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1ccc(N2CCOC(C)C2)nc1.I |
| InChI | InChI=1S/C19H25F3N6OS.HI/c1-13-11-28(7-8-29-13)16-4-3-14(9-25-16)10-26-18(23-2)24-6-5-17-27-15(12-30-17)19(20,21)22;/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | HODRNDFMVDUVMK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|