C17H26F3N5OS2 — CID 111689892
2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689892) has the molecular formula C17H26F3N5OS2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689892 |
| Molecular Formula | C17H26F3N5OS2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C17H26F3N5OS2/c1-21-15(22-4-2-14-24-13(10-28-14)17(18,19)20)23-11-16(3-9-27-12-16)25-5-7-26-8-6-25/h10H,2-9,11-12H2,1H3,(H2,21,22,23) |
| InChIKey | GDEISXNVVBUCLM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|