C18H42IN5 — CID 111691207
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide (PubChem CID 111691207) has the molecular formula C18H42IN5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111691207 |
| Molecular Formula | C18H42IN5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[3-[di(propan-2-yl)amino]propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCC(C)(C)CN(C)C.I |
| InChI | InChI=1S/C18H41N5.HI/c1-15(2)23(16(3)4)12-10-11-20-17(19-7)21-13-18(5,6)14-22(8)9;/h15-16H,10-14H2,1-9H3,(H2,19,20,21);1H |
| InChIKey | AHDZYBBINVQVSQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|