C14H33IN4 — CID 110978250
1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110978250) has the molecular formula C14H33IN4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110978250 |
| Molecular Formula | C14H33IN4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NCC(C)(C)CN(C)C.I |
| InChI | InChI=1S/C14H32N4.HI/c1-12(2)8-9-16-13(15-5)17-10-14(3,4)11-18(6)7;/h12H,8-11H2,1-7H3,(H2,15,16,17);1H |
| InChIKey | SGJIAXZHAARXRX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|