C13H30IN3 — CID 110979052
1-(3,3-dimethylbutyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 110979052) has the molecular formula C13H30IN3 and a molecular weight of 355.31 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(3,3-dimethylbutyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110979052 |
| Molecular Formula | C13H30IN3 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NCCC(C)(C)C.I |
| InChI | InChI=1S/C13H29N3.HI/c1-11(2)7-9-15-12(14-6)16-10-8-13(3,4)5;/h11H,7-10H2,1-6H3,(H2,14,15,16);1H |
| InChIKey | TZGQJCFKJJWCJW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|