C12H28IN3 — CID 110966837
1-tert-butyl-3-(3,3-dimethylbutyl)-2-methylguanidine;hydroiodide (PubChem CID 110966837) has the molecular formula C12H28IN3 and a molecular weight of 341.28 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,3-dimethylbutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-(3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110966837 |
| Molecular Formula | C12H28IN3 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-tert-butyl-3-(3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)(C)C)NC(C)(C)C.I |
| InChI | InChI=1S/C12H27N3.HI/c1-11(2,3)8-9-14-10(13-7)15-12(4,5)6;/h8-9H2,1-7H3,(H2,13,14,15);1H |
| InChIKey | BGDDGCRAQRUFSV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|