C14H22Cl2IN3 — CID 110964836
1-tert-butyl-3-[2-(3,5-dichlorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110964836) has the molecular formula C14H22Cl2IN3 and a molecular weight of 430.16 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(3,5-dichlorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-[2-(3,5-dichlorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110964836 |
| Molecular Formula | C14H22Cl2IN3 |
| Molecular Weight | 430.16 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 1-tert-butyl-3-[2-(3,5-dichlorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(Cl)cc(Cl)c1)NC(C)(C)C.I |
| InChI | InChI=1S/C14H21Cl2N3.HI/c1-14(2,3)19-13(17-4)18-6-5-10-7-11(15)9-12(16)8-10;/h7-9H,5-6H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | IDMIPMDVEBZFGO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.16 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|