C40H28N2O4 — CID 11169363
2-[4-[9-[4-(2-formyl-4-methoxyphenyl)phenyl]-1,10-phenanthrolin-2-yl]phenyl]-5-methoxybenzaldehyde (PubChem CID 11169363) has the molecular formula C40H28N2O4 and a molecular weight of 600.67 g/mol. Its IUPAC name is 2-[4-[9-[4-(2-formyl-4-methoxyphenyl)phenyl]-1,10-phenanthrolin-2-yl]phenyl]-5-methoxybenzaldehyde.
| Compound Name | 2-[4-[9-[4-(2-formyl-4-methoxyphenyl)phenyl]-1,10-phenanthrolin-2-yl]phenyl]-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 11169363 |
| Molecular Formula | C40H28N2O4 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2-[4-[9-[4-(2-formyl-4-methoxyphenyl)phenyl]-1,10-phenanthrolin-2-yl]phenyl]-5-methoxybenzaldehyde |
| SMILES | COc1ccc(-c2ccc(-c3ccc4ccc5ccc(-c6ccc(-c7ccc(OC)cc7C=O)cc6)nc5c4n3)cc2)c(C=O)c1 |
| InChI | InChI=1S/C40H28N2O4/c1-45-33-15-17-35(31(21-33)23-43)25-3-7-27(8-4-25)37-19-13-29-11-12-30-14-20-38(42-40(30)39(29)41-37)28-9-5-26(6-10-28)36-18-16-34(46-2)22-32(36)24-44/h3-24H,1-2H3 |
| InChIKey | ANMBCLGXTNJVQO-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|