C44H31N4O6P — CID 118445441
[4-[9-[3-methoxy-5-[9-(4-methoxyphenyl)-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthrolin-2-yl]phenyl] dihydrogen phosphate (PubChem CID 118445441) has the molecular formula C44H31N4O6P and a molecular weight of 742.73 g/mol. Its IUPAC name is [4-[9-[3-methoxy-5-[9-(4-methoxyphenyl)-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthrolin-2-yl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[9-[3-methoxy-5-[9-(4-methoxyphenyl)-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthrolin-2-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118445441 |
| Molecular Formula | C44H31N4O6P |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 742.20 |
| IUPAC Name | [4-[9-[3-methoxy-5-[9-(4-methoxyphenyl)-1,10-phenanthrolin-2-yl]phenyl]-1,10-phenanthrolin-2-yl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(-c2ccc3ccc4ccc(-c5cc(OC)cc(-c6ccc7ccc8ccc(-c9ccc(OP(=O)(O)O)cc9)nc8c7n6)c5)nc4c3n2)cc1 |
| InChI | InChI=1S/C44H31N4O6P/c1-52-34-15-7-26(8-16-34)37-19-11-28-3-5-30-13-21-39(47-43(30)41(28)45-37)32-23-33(25-36(24-32)53-2)40-22-14-31-6-4-29-12-20-38(46-42(29)44(31)48-40)27-9-17-35(18-10-27)54-55(49,50)51/h3-25H,1-2H3,(H2,49,50,51) |
| InChIKey | WYCVMLRHSPDKRS-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|