C25H37N5O — CID 111694572
1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111694572) has the molecular formula C25H37N5O and a molecular weight of 423.61 g/mol. Its IUPAC name is 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111694572 |
| Molecular Formula | C25H37N5O |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCC(CC)(CN/C(=N\C)NCc1ccc(N2CCOC(C)C2)nc1)c1ccccc1 |
| InChI | InChI=1S/C25H37N5O/c1-5-25(6-2,22-10-8-7-9-11-22)19-29-24(26-4)28-17-21-12-13-23(27-16-21)30-14-15-31-20(3)18-30/h7-13,16,20H,5-6,14-15,17-19H2,1-4H3,(H2,26,28,29) |
| InChIKey | DBVXOZCAMBVQHN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|