C19H20N2O3 — CID 111694889
4-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one (PubChem CID 111694889) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one.
| Compound Name | 4-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 111694889 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2cccc3ccccc23)C1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C19H20N2O3/c22-15-8-9-20(12-15)19(24)14-10-18(23)21(11-14)17-7-3-5-13-4-1-2-6-16(13)17/h1-7,14-15,22H,8-12H2/t14?,15-/m0/s1 |
| InChIKey | VAHDDCCVFVNPRL-LOACHALJSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |