C21H26ClN3O2 — CID 119560343
4-[4-(methylamino)piperidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one;hydrochloride (PubChem CID 119560343) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 4-[4-(methylamino)piperidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one;hydrochloride.
| Compound Name | 4-[4-(methylamino)piperidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119560343 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[4-(methylamino)piperidine-1-carbonyl]-1-naphthalen-1-ylpyrrolidin-2-one;hydrochloride |
| SMILES | CNC1CCN(C(=O)C2CC(=O)N(c3cccc4ccccc34)C2)CC1.Cl |
| InChI | InChI=1S/C21H25N3O2.ClH/c1-22-17-9-11-23(12-10-17)21(26)16-13-20(25)24(14-16)19-8-4-6-15-5-2-3-7-18(15)19;/h2-8,16-17,22H,9-14H2,1H3;1H |
| InChIKey | JTGCKDOIELBLFU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |