C35H30O10S — CID 11169676
methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfinyloxane-2-carboxylate (PubChem CID 11169676) has the molecular formula C35H30O10S and a molecular weight of 642.68 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfinyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfinyloxane-2-carboxylate |
|---|---|
| PubChem CID | 11169676 |
| Molecular Formula | C35H30O10S |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfinyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](S(=O)c2ccc(C)cc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H30O10S/c1-22-18-20-26(21-19-22)46(40)35-30(44-33(38)25-16-10-5-11-17-25)28(43-32(37)24-14-8-4-9-15-24)27(29(45-35)34(39)41-2)42-31(36)23-12-6-3-7-13-23/h3-21,27-30,35H,1-2H3/t27-,28-,29-,30+,35-,46?/m0/s1 |
| InChIKey | JMAWFRMTRMGSDD-DCXNDYNKSA-N |
| XLogP | 4.68 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|