C29H26O12S — CID 90799924
methyl (2S,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxy-6-methylsulfonyloxane-2-carboxylate (PubChem CID 90799924) has the molecular formula C29H26O12S and a molecular weight of 598.58 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxy-6-methylsulfonyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxy-6-methylsulfonyloxane-2-carboxylate |
|---|---|
| PubChem CID | 90799924 |
| Molecular Formula | C29H26O12S |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxy-6-methylsulfonyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@](O)(S(C)(=O)=O)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26O12S/c1-37-28(33)23-21(38-25(30)18-12-6-3-7-13-18)22(39-26(31)19-14-8-4-9-15-19)24(29(34,41-23)42(2,35)36)40-27(32)20-16-10-5-11-17-20/h3-17,21-24,34H,1-2H3/t21-,22-,23-,24+,29+/m0/s1 |
| InChIKey | QKIATOWNUYIYQZ-LDJGUTQZSA-N |
| XLogP | 1.93 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|