C29H25F3O12S — CID 141164578
[(2R,3S,4S,5S,6S)-4,5-dibenzoyl-4,5,6-trihydroxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate (PubChem CID 141164578) has the molecular formula C29H25F3O12S and a molecular weight of 654.57 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-4,5-dibenzoyl-4,5,6-trihydroxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5S,6S)-4,5-dibenzoyl-4,5,6-trihydroxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 141164578 |
| Molecular Formula | C29H25F3O12S |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.10 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-4,5-dibenzoyl-4,5,6-trihydroxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
| SMILES | CO[C@]1(O)O[C@H](COC(=O)c2ccccc2)[C@H](OS(=O)(=O)C(F)(F)F)[C@@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H25F3O12S/c1-41-28(38)27(37,23(34)19-13-7-3-8-14-19)26(36,22(33)18-11-5-2-6-12-18)24(44-45(39,40)29(30,31)32)21(43-28)17-42-25(35)20-15-9-4-10-16-20/h2-16,21,24,36-38H,17H2,1H3/t21-,24+,26+,27-,28+/m1/s1 |
| InChIKey | HDJAMXFOXBABGR-JUCQVTBNSA-N |
| XLogP | 2.00 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|