C28H25FO8 — CID 123799229
1-[(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3-fluoro-4,5-dihydroxy-6-methoxyoxan-2-yl]-2-hydroxy-2-phenylethanone (PubChem CID 123799229) has the molecular formula C28H25FO8 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3-fluoro-4,5-dihydroxy-6-methoxyoxan-2-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3-fluoro-4,5-dihydroxy-6-methoxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 123799229 |
| Molecular Formula | C28H25FO8 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 1-[(2R,3R,4S,5R,6S)-4,5-dibenzoyl-3-fluoro-4,5-dihydroxy-6-methoxyoxan-2-yl]-2-hydroxy-2-phenylethanone |
| SMILES | CO[C@H]1O[C@H](C(=O)C(O)c2ccccc2)[C@@H](F)[C@@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H25FO8/c1-36-26-28(35,25(33)19-15-9-4-10-16-19)27(34,24(32)18-13-7-3-8-14-18)23(29)22(37-26)21(31)20(30)17-11-5-2-6-12-17/h2-16,20,22-23,26,30,34-35H,1H3/t20?,22-,23-,26+,27-,28+/m1/s1 |
| InChIKey | YQFJZYLZFCQZCN-UKOVGAJFSA-N |
| XLogP | 2.23 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |