C18H22N2O2 — CID 111696845
N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(7-methyl-1H-indol-3-yl)propanamide (PubChem CID 111696845) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(7-methyl-1H-indol-3-yl)propanamide.
| Compound Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(7-methyl-1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 111696845 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(7-methyl-1H-indol-3-yl)propanamide |
| SMILES | Cc1cccc2c(CCC(=O)N[C@@H]3C=C[C@H](CO)C3)c[nH]c12 |
| InChI | InChI=1S/C18H22N2O2/c1-12-3-2-4-16-14(10-19-18(12)16)6-8-17(22)20-15-7-5-13(9-15)11-21/h2-5,7,10,13,15,19,21H,6,8-9,11H2,1H3,(H,20,22)/t13-,15+/m0/s1 |
| InChIKey | LTFMGECJJSDPNB-DZGCQCFKSA-N |
| XLogP | 2.46 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|