C18H26F3IN6O2 — CID 111699402
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111699402) has the molecular formula C18H26F3IN6O2 and a molecular weight of 542.34 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111699402 |
| Molecular Formula | C18H26F3IN6O2 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1ccc(OCC(F)(F)F)c(OC)c1.I |
| InChI | InChI=1S/C18H25F3N6O2.HI/c1-4-16-26-25-12-27(16)8-7-23-17(22-2)24-10-13-5-6-14(15(9-13)28-3)29-11-18(19,20)21;/h5-6,9,12H,4,7-8,10-11H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | SKIMWEWRJPFTMJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|