C20H32N8 — CID 111700693
1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111700693) has the molecular formula C20H32N8 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111700693 |
| Molecular Formula | C20H32N8 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 1-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C20H32N8/c1-3-18-26-25-16-28(18)13-10-22-20(21-2)24-15-17-8-9-19(23-14-17)27-11-6-4-5-7-12-27/h8-9,14,16H,3-7,10-13,15H2,1-2H3,(H2,21,22,24) |
| InChIKey | GBNKVNSJONKGST-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|