C20H32N8 — CID 111700685
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111700685) has the molecular formula C20H32N8 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111700685 |
| Molecular Formula | C20H32N8 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1ccc(N2CCC(C)CC2)nc1 |
| InChI | InChI=1S/C20H32N8/c1-4-18-26-25-15-28(18)12-9-22-20(21-3)24-14-17-5-6-19(23-13-17)27-10-7-16(2)8-11-27/h5-6,13,15-16H,4,7-12,14H2,1-3H3,(H2,21,22,24) |
| InChIKey | BWJQKWYTPXDWDH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|