C20H33IN6O — CID 111700874
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111700874) has the molecular formula C20H33IN6O and a molecular weight of 500.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111700874 |
| Molecular Formula | C20H33IN6O |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(OC)cc1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C20H32N6O.HI/c1-6-18-25-24-15-26(18)13-12-22-19(21-7-2)23-14-20(3,4)16-8-10-17(27-5)11-9-16;/h8-11,15H,6-7,12-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | ABGNMYMQYGVKEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|