C21H32N8O — CID 111701223
N-[3-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 111701223) has the molecular formula C21H32N8O and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111701223 |
| Molecular Formula | C21H32N8O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[3-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H32N8O/c1-3-19-27-25-16-29(19)13-10-23-20(22-4-2)24-15-17-8-7-9-18(14-17)26-21(30)28-11-5-6-12-28/h7-9,14,16H,3-6,10-13,15H2,1-2H3,(H,26,30)(H2,22,23,24) |
| InChIKey | RSLHQAGSKNDCSY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|