C19H28N4O2S2 — CID 111702995
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111702995) has the molecular formula C19H28N4O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111702995 |
| Molecular Formula | C19H28N4O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cc(C)ccc1C)NCC(C)c1ccsc1 |
| InChI | InChI=1S/C19H28N4O2S2/c1-14-5-6-15(2)18(11-14)27(24,25)23-9-8-21-19(20-4)22-12-16(3)17-7-10-26-13-17/h5-7,10-11,13,16,23H,8-9,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | JSRNTEAICRLRQI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|