C17H26N6O3 — CID 111706683
1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111706683) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111706683 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)NCc1ncnn1C |
| InChI | InChI=1S/C17H26N6O3/c1-6-18-17(20-10-16-21-11-22-23(16)2)19-9-12-7-14(25-4)15(26-5)8-13(12)24-3/h7-8,11H,6,9-10H2,1-5H3,(H2,18,19,20) |
| InChIKey | QZMCQZYPZRDJOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|