C17H26IN7 — CID 111707776
2-methyl-1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111707776) has the molecular formula C17H26IN7 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111707776 |
| Molecular Formula | C17H26IN7 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1c2ccccc2CC1C)NCc1ncnn1C.I |
| InChI | InChI=1S/C17H25N7.HI/c1-13-10-14-6-4-5-7-15(14)24(13)9-8-19-17(18-2)20-11-16-21-12-22-23(16)3;/h4-7,12-13H,8-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | BUDZZCWLVHHAHH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|