C14H19FN6S — CID 84587047
1-[2-(2-fluorophenyl)sulfanylethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 84587047) has the molecular formula C14H19FN6S and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfanylethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 84587047 |
| Molecular Formula | C14H19FN6S |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCSc1ccccc1F)NCc1ncnn1C |
| InChI | InChI=1S/C14H19FN6S/c1-16-14(18-9-13-19-10-20-21(13)2)17-7-8-22-12-6-4-3-5-11(12)15/h3-6,10H,7-9H2,1-2H3,(H2,16,17,18) |
| InChIKey | KLWWBGSIJIBUJB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|