C18H24F2N6 — CID 111706921
1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111706921) has the molecular formula C18H24F2N6 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111706921 |
| Molecular Formula | C18H24F2N6 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[[1-(2,6-difluorophenyl)cyclopentyl]methyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncnn1C)NCC1(c2c(F)cccc2F)CCCC1 |
| InChI | InChI=1S/C18H24F2N6/c1-21-17(22-10-15-24-12-25-26(15)2)23-11-18(8-3-4-9-18)16-13(19)6-5-7-14(16)20/h5-7,12H,3-4,8-11H2,1-2H3,(H2,21,22,23) |
| InChIKey | LKFARRIUEQJJMR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|