C18H34N8 — CID 111989561
2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111989561) has the molecular formula C18H34N8 and a molecular weight of 362.53 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111989561 |
| Molecular Formula | C18H34N8 |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncnn1C)NCC1(N2CCCCC2)CCN(C)CC1 |
| InChI | InChI=1S/C18H34N8/c1-19-17(20-13-16-22-15-23-25(16)3)21-14-18(7-11-24(2)12-8-18)26-9-5-4-6-10-26/h15H,4-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | OVKFEJNAICNFJO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|