C21H33Cl2N5 — CID 111497415
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine (PubChem CID 111497415) has the molecular formula C21H33Cl2N5 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111497415 |
| Molecular Formula | C21H33Cl2N5 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1Cl)NCC1(N2CCCCC2)CCN(C)CC1 |
| InChI | InChI=1S/C21H33Cl2N5/c1-24-20(25-15-17-6-7-18(22)14-19(17)23)26-16-21(8-12-27(2)13-9-21)28-10-4-3-5-11-28/h6-7,14H,3-5,8-13,15-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | BBMLCEFONGMKGC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|