About (4-azidophenyl)methanol
(4-azidophenyl)methanol (PubChem CID 11171062) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is (4-azidophenyl)methanol.
Molecular Properties
| Compound Name | (4-azidophenyl)methanol |
| PubChem CID | 11171062 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (4-azidophenyl)methanol |
| SMILES | [N-]=[N+]=Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C7H7N3O/c8-10-9-7-3-1-6(5-11)2-4-7/h1-4,11H,5H2 |
| InChIKey | GEKVUCLUCOBNIE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-azidophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azidophenyl)methanol?
The IUPAC name of (4-azidophenyl)methanol (CID 11171062) is (4-azidophenyl)methanol.
What is the SMILES notation for (4-azidophenyl)methanol?
The canonical SMILES for (4-azidophenyl)methanol is [N-]=[N+]=Nc1ccc(CO)cc1.
What is the InChIKey of (4-azidophenyl)methanol?
The InChIKey is GEKVUCLUCOBNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-10-9-7-3-1-6(5-11)2-4-7/h1-4,11H,5H2.
What are the key properties of (4-azidophenyl)methanol?
(4-azidophenyl)methanol has a molecular weight of 149.15 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azidophenyl)methanol is sourced from PubChem (CID 11171062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).