C16H34N4O — CID 111710853
1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111710853) has the molecular formula C16H34N4O and a molecular weight of 298.48 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111710853 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | CCN1CCC(CN/C(=N/C)NCC(OC)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H34N4O/c1-7-20-9-8-13(12-20)10-18-15(17-5)19-11-14(21-6)16(2,3)4/h13-14H,7-12H2,1-6H3,(H2,17,18,19) |
| InChIKey | SWDHFVTVQJGCBN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|