C23H31F3IN5O — CID 111711684
2-methyl-1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide (PubChem CID 111711684) has the molecular formula C23H31F3IN5O and a molecular weight of 577.43 g/mol. Its IUPAC name is 2-methyl-1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111711684 |
| Molecular Formula | C23H31F3IN5O |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 2-methyl-1-[(2-morpholin-4-yl-3-pyridinyl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(C)c1cccc(C(F)(F)F)c1)NCc1cccnc1N1CCOCC1.I |
| InChI | InChI=1S/C23H30F3N5O.HI/c1-17(18-5-3-7-20(15-18)23(24,25)26)8-10-29-22(27-2)30-16-19-6-4-9-28-21(19)31-11-13-32-14-12-31;/h3-7,9,15,17H,8,10-14,16H2,1-2H3,(H2,27,29,30);1H |
| InChIKey | KQZNKUJDKCVKCN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|