C18H36IN5O — CID 111712409
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111712409) has the molecular formula C18H36IN5O and a molecular weight of 465.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111712409 |
| Molecular Formula | C18H36IN5O |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C18H35N5O.HI/c1-5-8-17(9-12-24)14-21-18(19-6-2)20-10-7-11-23-16(4)13-15(3)22-23;/h13,17,24H,5-12,14H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | GALBOICTMLEHSD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|