C18H31FIN3O2 — CID 111712670
1-ethyl-3-[2-(3-fluorophenoxy)ethyl]-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111712670) has the molecular formula C18H31FIN3O2 and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenoxy)ethyl]-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenoxy)ethyl]-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111712670 |
| Molecular Formula | C18H31FIN3O2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenoxy)ethyl]-2-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCOc1cccc(F)c1.I |
| InChI | InChI=1S/C18H30FN3O2.HI/c1-3-6-15(9-11-23)14-22-18(20-4-2)21-10-12-24-17-8-5-7-16(19)13-17;/h5,7-8,13,15,23H,3-4,6,9-12,14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | HSEQVWBBDUJSHP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|