C17H21ClFN3O2S — CID 111702025
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine (PubChem CID 111702025) has the molecular formula C17H21ClFN3O2S and a molecular weight of 385.89 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111702025 |
| Molecular Formula | C17H21ClFN3O2S |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-fluorophenoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C17H21ClFN3O2S/c1-2-20-17(22-11-14(23)15-6-7-16(18)25-15)21-8-9-24-13-5-3-4-12(19)10-13/h3-7,10,14,23H,2,8-9,11H2,1H3,(H2,20,21,22) |
| InChIKey | YDWAFTDGJUFWML-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|