C13H30N4O3S — CID 111712737
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(methanesulfonamido)ethyl]guanidine (PubChem CID 111712737) has the molecular formula C13H30N4O3S and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(methanesulfonamido)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(methanesulfonamido)ethyl]guanidine |
|---|---|
| PubChem CID | 111712737 |
| Molecular Formula | C13H30N4O3S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-[2-(methanesulfonamido)ethyl]guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H30N4O3S/c1-4-6-12(7-10-18)11-16-13(14-5-2)15-8-9-17-21(3,19)20/h12,17-18H,4-11H2,1-3H3,(H2,14,15,16) |
| InChIKey | ZRPHVWFJEWMXOI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|