C14H31N3O3S — CID 111713151
1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(3-methylsulfonylpropyl)guanidine (PubChem CID 111713151) has the molecular formula C14H31N3O3S and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111713151 |
| Molecular Formula | C14H31N3O3S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-ethyl-2-[2-(2-hydroxyethyl)pentyl]-3-(3-methylsulfonylpropyl)guanidine |
| SMILES | CCCC(CCO)C/N=C(\NCC)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C14H31N3O3S/c1-4-7-13(8-10-18)12-17-14(15-5-2)16-9-6-11-21(3,19)20/h13,18H,4-12H2,1-3H3,(H2,15,16,17) |
| InChIKey | UZUNEJHEBUFIBA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|