C24H37IN4O3 — CID 111713060
2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111713060) has the molecular formula C24H37IN4O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is 2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111713060 |
| Molecular Formula | C24H37IN4O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)CN/C(=N/Cc1ccnc(Oc2ccc(OCC)cc2)c1)NCC.I |
| InChI | InChI=1S/C24H36N4O3.HI/c1-4-7-19(13-15-29)17-27-24(25-5-2)28-18-20-12-14-26-23(16-20)31-22-10-8-21(9-11-22)30-6-3;/h8-12,14,16,19,29H,4-7,13,15,17-18H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | NGPYCAASBFFQEZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|