C22H44N4O2 — CID 111715584
1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111715584) has the molecular formula C22H44N4O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111715584 |
| Molecular Formula | C22H44N4O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)NCC(CCO)CC(C)C |
| InChI | InChI=1S/C22H44N4O2/c1-4-23-21(24-17-20(8-13-27)16-19(2)3)25-18-22(9-6-5-7-10-22)26-11-14-28-15-12-26/h19-20,27H,4-18H2,1-3H3,(H2,23,24,25) |
| InChIKey | PMMVKZIBLHMSJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|