C21H36N4O2 — CID 111718600
N-[2-[[N'-(3-ethoxy-4-methylpentyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methylbenzamide (PubChem CID 111718600) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-[2-[[N'-(3-ethoxy-4-methylpentyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[[N'-(3-ethoxy-4-methylpentyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 111718600 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | N-[2-[[N'-(3-ethoxy-4-methylpentyl)-N-ethylcarbamimidoyl]amino]ethyl]-3-methylbenzamide |
| SMILES | CCN/C(=N\CCC(OCC)C(C)C)NCCNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C21H36N4O2/c1-6-22-21(24-12-11-19(16(3)4)27-7-2)25-14-13-23-20(26)18-10-8-9-17(5)15-18/h8-10,15-16,19H,6-7,11-14H2,1-5H3,(H,23,26)(H2,22,24,25) |
| InChIKey | NUPHWYLXHDATJY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|