C17H26N4O — CID 111961383
N-[2-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]ethyl]-3-methylbenzamide (PubChem CID 111961383) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 111961383 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[2-[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]ethyl]-3-methylbenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccc(C)c1)NC1CC1C |
| InChI | InChI=1S/C17H26N4O/c1-4-18-17(21-15-11-13(15)3)20-9-8-19-16(22)14-7-5-6-12(2)10-14/h5-7,10,13,15H,4,8-9,11H2,1-3H3,(H,19,22)(H2,18,20,21) |
| InChIKey | GWJLSNKVHAUWKH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|